C26H41NO2 — CID 78164768
3,7,11-trimethyldodeca-2,6,10-trienyl N-(1-adamantyl)carbamate (PubChem CID 78164768) has the molecular formula C26H41NO2 and a molecular weight of 399.62 g/mol. Its IUPAC name is 3,7,11-trimethyldodeca-2,6,10-trienyl N-(1-adamantyl)carbamate.
| Compound Name | 3,7,11-trimethyldodeca-2,6,10-trienyl N-(1-adamantyl)carbamate |
|---|---|
| PubChem CID | 78164768 |
| Molecular Formula | C26H41NO2 |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.31 |
| IUPAC Name | 3,7,11-trimethyldodeca-2,6,10-trienyl N-(1-adamantyl)carbamate |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCOC(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C26H41NO2/c1-19(2)7-5-8-20(3)9-6-10-21(4)11-12-29-25(28)27-26-16-22-13-23(17-26)15-24(14-22)18-26/h7,9,11,22-24H,5-6,8,10,12-18H2,1-4H3,(H,27,28) |
| InChIKey | JSUUTDWKAQSAOX-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|