C14H22O2 — CID 137492081
[(2Z)-3,7-dimethylocta-2,6-dienyl] cyclopropanecarboxylate (PubChem CID 137492081) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is [(2Z)-3,7-dimethylocta-2,6-dienyl] cyclopropanecarboxylate.
| Compound Name | [(2Z)-3,7-dimethylocta-2,6-dienyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 137492081 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | [(2Z)-3,7-dimethylocta-2,6-dienyl] cyclopropanecarboxylate |
| SMILES | CC(C)=CCC/C(C)=C\COC(=O)C1CC1 |
| InChI | InChI=1S/C14H22O2/c1-11(2)5-4-6-12(3)9-10-16-14(15)13-7-8-13/h5,9,13H,4,6-8,10H2,1-3H3/b12-9- |
| InChIKey | YTMOEYMXUBQWCM-XFXZXTDPSA-N |
| XLogP | 3.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|