C15H24O2 — CID 137492389
[(2Z)-3,7-dimethylocta-2,6-dienyl] cyclobutanecarboxylate (PubChem CID 137492389) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is [(2Z)-3,7-dimethylocta-2,6-dienyl] cyclobutanecarboxylate.
| Compound Name | [(2Z)-3,7-dimethylocta-2,6-dienyl] cyclobutanecarboxylate |
|---|---|
| PubChem CID | 137492389 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | [(2Z)-3,7-dimethylocta-2,6-dienyl] cyclobutanecarboxylate |
| SMILES | CC(C)=CCC/C(C)=C\COC(=O)C1CCC1 |
| InChI | InChI=1S/C15H24O2/c1-12(2)6-4-7-13(3)10-11-17-15(16)14-8-5-9-14/h6,10,14H,4-5,7-9,11H2,1-3H3/b13-10- |
| InChIKey | SOLKRNIJQXYOOV-RAXLEYEMSA-N |
| XLogP | 4.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|