C19H31NOS — CID 71735111
O-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] N-cyclopropylcarbamothioate (PubChem CID 71735111) has the molecular formula C19H31NOS and a molecular weight of 321.53 g/mol. Its IUPAC name is O-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] N-cyclopropylcarbamothioate.
| Compound Name | O-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] N-cyclopropylcarbamothioate |
|---|---|
| PubChem CID | 71735111 |
| Molecular Formula | C19H31NOS |
| Molecular Weight | 321.53 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | O-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] N-cyclopropylcarbamothioate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/COC(=S)NC1CC1 |
| InChI | InChI=1S/C19H31NOS/c1-15(2)7-5-8-16(3)9-6-10-17(4)13-14-21-19(22)20-18-11-12-18/h7,9,13,18H,5-6,8,10-12,14H2,1-4H3,(H,20,22)/b16-9+,17-13+ |
| InChIKey | IBJTVYUAIWSTAT-LRUHSSMMSA-N |
| XLogP | 5.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.53 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|