C28H45NOS — CID 123851685
O-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl) N-(2-bicyclo[2.2.1]heptanyl)carbamothioate (PubChem CID 123851685) has the molecular formula C28H45NOS and a molecular weight of 443.74 g/mol. Its IUPAC name is O-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl) N-(2-bicyclo[2.2.1]heptanyl)carbamothioate.
| Compound Name | O-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl) N-(2-bicyclo[2.2.1]heptanyl)carbamothioate |
|---|---|
| PubChem CID | 123851685 |
| Molecular Formula | C28H45NOS |
| Molecular Weight | 443.74 g/mol |
| Exact Mass | 443.32 |
| IUPAC Name | O-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl) N-(2-bicyclo[2.2.1]heptanyl)carbamothioate |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOC(=S)NC1CC2CCC1C2 |
| InChI | InChI=1S/C28H45NOS/c1-21(2)9-6-10-22(3)11-7-12-23(4)13-8-14-24(5)17-18-30-28(31)29-27-20-25-15-16-26(27)19-25/h9,11,13,17,25-27H,6-8,10,12,14-16,18-20H2,1-5H3,(H,29,31) |
| InChIKey | RDBYCEZRRKTVSA-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.74 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|