C26H44OS — CID 146803287
O-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl] hexanethioate (PubChem CID 146803287) has the molecular formula C26H44OS and a molecular weight of 404.70 g/mol. Its IUPAC name is O-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl] hexanethioate.
| Compound Name | O-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl] hexanethioate |
|---|---|
| PubChem CID | 146803287 |
| Molecular Formula | C26H44OS |
| Molecular Weight | 404.70 g/mol |
| Exact Mass | 404.31 |
| IUPAC Name | O-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl] hexanethioate |
| SMILES | CCCCCC(=S)OC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C26H44OS/c1-7-8-9-19-26(28)27-21-20-25(6)18-12-17-24(5)16-11-15-23(4)14-10-13-22(2)3/h13,15,17,20H,7-12,14,16,18-19,21H2,1-6H3/b23-15+,24-17+,25-20+ |
| InChIKey | RYIQUCKHVYSUKR-GNAHMUSISA-N |
| XLogP | 9.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.70 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|