C24H40OS — CID 149184814
O-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl] butanethioate (PubChem CID 149184814) has the molecular formula C24H40OS and a molecular weight of 376.65 g/mol. Its IUPAC name is O-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl] butanethioate.
| Compound Name | O-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl] butanethioate |
|---|---|
| PubChem CID | 149184814 |
| Molecular Formula | C24H40OS |
| Molecular Weight | 376.65 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | O-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl] butanethioate |
| SMILES | CCCC(=S)OC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C24H40OS/c1-7-11-24(26)25-19-18-23(6)17-10-16-22(5)15-9-14-21(4)13-8-12-20(2)3/h12,14,16,18H,7-11,13,15,17,19H2,1-6H3/b21-14+,22-16+,23-18+ |
| InChIKey | XBRAJBXTZOPXHW-INVBOZNNSA-N |
| XLogP | 8.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.65 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|