C48H74O3 — CID 162436832
1-[(2E,6E)-3,7-dimethyldeca-2,6-dienoxy]-3,5-bis[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]benzene (PubChem CID 162436832) has the molecular formula C48H74O3 and a molecular weight of 699.12 g/mol. Its IUPAC name is 1-[(2E,6E)-3,7-dimethyldeca-2,6-dienoxy]-3,5-bis[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]benzene.
| Compound Name | 1-[(2E,6E)-3,7-dimethyldeca-2,6-dienoxy]-3,5-bis[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]benzene |
|---|---|
| PubChem CID | 162436832 |
| Molecular Formula | C48H74O3 |
| Molecular Weight | 699.12 g/mol |
| Exact Mass | 698.56 |
| IUPAC Name | 1-[(2E,6E)-3,7-dimethyldeca-2,6-dienoxy]-3,5-bis[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]benzene |
| SMILES | CCC/C(C)=C/CC/C(C)=C/COc1cc(OC/C=C(\C)CC/C=C(\C)CCC=C(C)C)cc(OC/C=C(\C)CC/C=C(\C)CCC=C(C)C)c1 |
| InChI | InChI=1S/C48H74O3/c1-12-18-40(6)23-15-26-43(9)29-32-49-46-35-47(50-33-30-44(10)27-16-24-41(7)21-13-19-38(2)3)37-48(36-46)51-34-31-45(11)28-17-25-42(8)22-14-20-39(4)5/h19-20,23-25,29-31,35-37H,12-18,21-22,26-28,32-34H2,1-11H3/b40-23+,41-24+,42-25+,43-29+,44-30+,45-31+ |
| InChIKey | GQKHCHMKACIYMT-GZRQXELTSA-N |
| XLogP | 15.13 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.12 |
| LogP ≤ 5 | 15.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|