C39H54O5 — CID 22854151
3,4,7-tris[(2E)-3,7-dimethylocta-2,6-dienoxy]chromen-2-one (PubChem CID 22854151) has the molecular formula C39H54O5 and a molecular weight of 602.86 g/mol. Its IUPAC name is 3,4,7-tris[(2E)-3,7-dimethylocta-2,6-dienoxy]chromen-2-one.
| Compound Name | 3,4,7-tris[(2E)-3,7-dimethylocta-2,6-dienoxy]chromen-2-one |
|---|---|
| PubChem CID | 22854151 |
| Molecular Formula | C39H54O5 |
| Molecular Weight | 602.86 g/mol |
| Exact Mass | 602.40 |
| IUPAC Name | 3,4,7-tris[(2E)-3,7-dimethylocta-2,6-dienoxy]chromen-2-one |
| SMILES | CC(C)=CCC/C(C)=C/COc1ccc2c(OC/C=C(\C)CCC=C(C)C)c(OC/C=C(\C)CCC=C(C)C)c(=O)oc2c1 |
| InChI | InChI=1S/C39H54O5/c1-28(2)13-10-16-31(7)21-24-41-34-19-20-35-36(27-34)44-39(40)38(43-26-23-33(9)18-12-15-30(5)6)37(35)42-25-22-32(8)17-11-14-29(3)4/h13-15,19-23,27H,10-12,16-18,24-26H2,1-9H3/b31-21+,32-22+,33-23+ |
| InChIKey | DNRGJFMAKDEPCK-PUDZBMOJSA-N |
| XLogP | 11.01 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.86 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|