C25H34O5 — CID 54370858
7-(3,7-dimethylocta-2,6-dienoxy)-3,4-di(propan-2-yloxy)chromen-2-one (PubChem CID 54370858) has the molecular formula C25H34O5 and a molecular weight of 414.54 g/mol. Its IUPAC name is 7-(3,7-dimethylocta-2,6-dienoxy)-3,4-di(propan-2-yloxy)chromen-2-one.
| Compound Name | 7-(3,7-dimethylocta-2,6-dienoxy)-3,4-di(propan-2-yloxy)chromen-2-one |
|---|---|
| PubChem CID | 54370858 |
| Molecular Formula | C25H34O5 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 7-(3,7-dimethylocta-2,6-dienoxy)-3,4-di(propan-2-yloxy)chromen-2-one |
| SMILES | CC(C)=CCCC(C)=CCOc1ccc2c(OC(C)C)c(OC(C)C)c(=O)oc2c1 |
| InChI | InChI=1S/C25H34O5/c1-16(2)9-8-10-19(7)13-14-27-20-11-12-21-22(15-20)30-25(26)24(29-18(5)6)23(21)28-17(3)4/h9,11-13,15,17-18H,8,10,14H2,1-7H3 |
| InChIKey | UTBZPEJPHGOBQL-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|