C22H28O5 — CID 54572271
4-(3,7-dimethylocta-2,6-dienoxy)-5-hydroxy-3-propan-2-yloxychromen-2-one (PubChem CID 54572271) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is 4-(3,7-dimethylocta-2,6-dienoxy)-5-hydroxy-3-propan-2-yloxychromen-2-one.
| Compound Name | 4-(3,7-dimethylocta-2,6-dienoxy)-5-hydroxy-3-propan-2-yloxychromen-2-one |
|---|---|
| PubChem CID | 54572271 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 4-(3,7-dimethylocta-2,6-dienoxy)-5-hydroxy-3-propan-2-yloxychromen-2-one |
| SMILES | CC(C)=CCCC(C)=CCOc1c(OC(C)C)c(=O)oc2cccc(O)c12 |
| InChI | InChI=1S/C22H28O5/c1-14(2)8-6-9-16(5)12-13-25-20-19-17(23)10-7-11-18(19)27-22(24)21(20)26-15(3)4/h7-8,10-12,15,23H,6,9,13H2,1-5H3 |
| InChIKey | ZYDPISQSTJCFGY-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|