C23H26O7 — CID 54034628
[3-acetyloxy-4-(3,7-dimethylocta-2,6-dienoxy)-2-oxochromen-5-yl] acetate (PubChem CID 54034628) has the molecular formula C23H26O7 and a molecular weight of 414.45 g/mol. Its IUPAC name is [3-acetyloxy-4-(3,7-dimethylocta-2,6-dienoxy)-2-oxochromen-5-yl] acetate.
| Compound Name | [3-acetyloxy-4-(3,7-dimethylocta-2,6-dienoxy)-2-oxochromen-5-yl] acetate |
|---|---|
| PubChem CID | 54034628 |
| Molecular Formula | C23H26O7 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | [3-acetyloxy-4-(3,7-dimethylocta-2,6-dienoxy)-2-oxochromen-5-yl] acetate |
| SMILES | CC(=O)Oc1c(OCC=C(C)CCC=C(C)C)c2c(OC(C)=O)cccc2oc1=O |
| InChI | InChI=1S/C23H26O7/c1-14(2)8-6-9-15(3)12-13-27-21-20-18(28-16(4)24)10-7-11-19(20)30-23(26)22(21)29-17(5)25/h7-8,10-12H,6,9,13H2,1-5H3 |
| InChIKey | LIAOJAIEZHSDMT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|