C27H34O6 — CID 54404191
[4-(3,7-dimethylocta-2,6-dienoxy)-3-hex-3-enoxy-2-oxochromen-5-yl] acetate (PubChem CID 54404191) has the molecular formula C27H34O6 and a molecular weight of 454.56 g/mol. Its IUPAC name is [4-(3,7-dimethylocta-2,6-dienoxy)-3-hex-3-enoxy-2-oxochromen-5-yl] acetate.
| Compound Name | [4-(3,7-dimethylocta-2,6-dienoxy)-3-hex-3-enoxy-2-oxochromen-5-yl] acetate |
|---|---|
| PubChem CID | 54404191 |
| Molecular Formula | C27H34O6 |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | [4-(3,7-dimethylocta-2,6-dienoxy)-3-hex-3-enoxy-2-oxochromen-5-yl] acetate |
| SMILES | CCC=CCCOc1c(OCC=C(C)CCC=C(C)C)c2c(OC(C)=O)cccc2oc1=O |
| InChI | InChI=1S/C27H34O6/c1-6-7-8-9-17-30-26-25(31-18-16-20(4)13-10-12-19(2)3)24-22(32-21(5)28)14-11-15-23(24)33-27(26)29/h7-8,11-12,14-16H,6,9-10,13,17-18H2,1-5H3 |
| InChIKey | VPMLZENSHVQFSO-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|