C30H40O5 — CID 22854217
4,5-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-3-methoxychromen-2-one (PubChem CID 22854217) has the molecular formula C30H40O5 and a molecular weight of 480.65 g/mol. Its IUPAC name is 4,5-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-3-methoxychromen-2-one.
| Compound Name | 4,5-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-3-methoxychromen-2-one |
|---|---|
| PubChem CID | 22854217 |
| Molecular Formula | C30H40O5 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.29 |
| IUPAC Name | 4,5-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-3-methoxychromen-2-one |
| SMILES | COc1c(OC/C=C(\C)CCC=C(C)C)c2c(OC/C=C(\C)CCC=C(C)C)cccc2oc1=O |
| InChI | InChI=1S/C30H40O5/c1-21(2)11-8-13-23(5)17-19-33-25-15-10-16-26-27(25)28(29(32-7)30(31)35-26)34-20-18-24(6)14-9-12-22(3)4/h10-12,15-18H,8-9,13-14,19-20H2,1-7H3/b23-17+,24-18+ |
| InChIKey | CPBNOODKDQFBEM-GJHDBBOXSA-N |
| XLogP | 7.94 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|