C29H38O5 — CID 54734730
3,5-bis(3,7-dimethylocta-2,6-dienoxy)-4-hydroxychromen-2-one (PubChem CID 54734730) has the molecular formula C29H38O5 and a molecular weight of 466.62 g/mol. Its IUPAC name is 3,5-bis(3,7-dimethylocta-2,6-dienoxy)-4-hydroxychromen-2-one.
| Compound Name | 3,5-bis(3,7-dimethylocta-2,6-dienoxy)-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 54734730 |
| Molecular Formula | C29H38O5 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | 3,5-bis(3,7-dimethylocta-2,6-dienoxy)-4-hydroxychromen-2-one |
| SMILES | CC(C)=CCCC(C)=CCOc1c(O)c2c(OCC=C(C)CCC=C(C)C)cccc2oc1=O |
| InChI | InChI=1S/C29H38O5/c1-20(2)10-7-12-22(5)16-18-32-24-14-9-15-25-26(24)27(30)28(29(31)34-25)33-19-17-23(6)13-8-11-21(3)4/h9-11,14-17,30H,7-8,12-13,18-19H2,1-6H3 |
| InChIKey | CTKFHDHJUYGIJC-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|