C31H44O6 — CID 19929711
[4-decoxy-5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-oxochromen-3-yl] acetate (PubChem CID 19929711) has the molecular formula C31H44O6 and a molecular weight of 512.69 g/mol. Its IUPAC name is [4-decoxy-5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-oxochromen-3-yl] acetate.
| Compound Name | [4-decoxy-5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-oxochromen-3-yl] acetate |
|---|---|
| PubChem CID | 19929711 |
| Molecular Formula | C31H44O6 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.31 |
| IUPAC Name | [4-decoxy-5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-oxochromen-3-yl] acetate |
| SMILES | CCCCCCCCCCOc1c(OC(C)=O)c(=O)oc2cccc(OC/C=C(\C)CCC=C(C)C)c12 |
| InChI | InChI=1S/C31H44O6/c1-6-7-8-9-10-11-12-13-21-35-29-28-26(34-22-20-24(4)17-14-16-23(2)3)18-15-19-27(28)37-31(33)30(29)36-25(5)32/h15-16,18-20H,6-14,17,21-22H2,1-5H3/b24-20+ |
| InChIKey | OVTBQHWDSZISAS-HIXSDJFHSA-N |
| XLogP | 8.31 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|