(3,5-didecoxy-2-oxochromen-4-yl) acetate

C31H48O6 — CID 19929452

IUPAC(3,5-didecoxy-2-oxochromen-4-yl) acetate
SMILESCCCCCCCCCCOc1c(OC(C)=O)c2c(OCCCCCCCCCC)cccc2oc1=O
InChIInChI=1S/C31H48O6/c1-4-6-8-10-12-14-16-18-23-34-26-21-20-22-27-28(26)29(36-25(3)32)30(31(33)37-27)35-24-19-17-15-13-11-9-7-5-2/h20-22H,4-19,23-24H2,1-3H3
InChIKeyUWKGCSAWSMSUON-UHFFFAOYSA-N
MW516.72 g/mol
LogP8.76
Rot. Bonds21

About (3,5-didecoxy-2-oxochromen-4-yl) acetate

(3,5-didecoxy-2-oxochromen-4-yl) acetate (PubChem CID 19929452) has the molecular formula C31H48O6 and a molecular weight of 516.72 g/mol. Its IUPAC name is (3,5-didecoxy-2-oxochromen-4-yl) acetate.

Molecular Properties

Compound Name(3,5-didecoxy-2-oxochromen-4-yl) acetate
PubChem CID19929452
Molecular FormulaC31H48O6
Molecular Weight516.72 g/mol
Exact Mass516.35
IUPAC Name(3,5-didecoxy-2-oxochromen-4-yl) acetate
SMILESCCCCCCCCCCOc1c(OC(C)=O)c2c(OCCCCCCCCCC)cccc2oc1=O
InChIInChI=1S/C31H48O6/c1-4-6-8-10-12-14-16-18-23-34-26-21-20-22-27-28(26)29(36-25(3)32)30(31(33)37-27)35-24-19-17-15-13-11-9-7-5-2/h20-22H,4-19,23-24H2,1-3H3
InChIKeyUWKGCSAWSMSUON-UHFFFAOYSA-N
XLogP8.76
TPSA74.97 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds21
Heavy Atoms37
Complexity—

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500516.72
LogP ≤ 58.76
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}

Analyze (3,5-didecoxy-2-oxochromen-4-yl) acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3,5-didecoxy-2-oxochromen-4-yl) acetate?
The IUPAC name of (3,5-didecoxy-2-oxochromen-4-yl) acetate (CID 19929452) is (3,5-didecoxy-2-oxochromen-4-yl) acetate.
What is the SMILES notation for (3,5-didecoxy-2-oxochromen-4-yl) acetate?
The canonical SMILES for (3,5-didecoxy-2-oxochromen-4-yl) acetate is CCCCCCCCCCOc1c(OC(C)=O)c2c(OCCCCCCCCCC)cccc2oc1=O.
What is the InChIKey of (3,5-didecoxy-2-oxochromen-4-yl) acetate?
The InChIKey is UWKGCSAWSMSUON-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H48O6/c1-4-6-8-10-12-14-16-18-23-34-26-21-20-22-27-28(26)29(36-25(3)32)30(31(33)37-27)35-24-19-17-15-13-11-9-7-5-2/h20-22H,4-19,23-24H2,1-3H3.
What are the key properties of (3,5-didecoxy-2-oxochromen-4-yl) acetate?
(3,5-didecoxy-2-oxochromen-4-yl) acetate has a molecular weight of 516.72 g/mol, XLogP of 8.76, 21 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-didecoxy-2-oxochromen-4-yl) acetate is sourced from PubChem (CID 19929452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).