C31H48O6 — CID 19929452
(3,5-didecoxy-2-oxochromen-4-yl) acetate (PubChem CID 19929452) has the molecular formula C31H48O6 and a molecular weight of 516.72 g/mol. Its IUPAC name is (3,5-didecoxy-2-oxochromen-4-yl) acetate.
| Compound Name | (3,5-didecoxy-2-oxochromen-4-yl) acetate |
|---|---|
| PubChem CID | 19929452 |
| Molecular Formula | C31H48O6 |
| Molecular Weight | 516.72 g/mol |
| Exact Mass | 516.35 |
| IUPAC Name | (3,5-didecoxy-2-oxochromen-4-yl) acetate |
| SMILES | CCCCCCCCCCOc1c(OC(C)=O)c2c(OCCCCCCCCCC)cccc2oc1=O |
| InChI | InChI=1S/C31H48O6/c1-4-6-8-10-12-14-16-18-23-34-26-21-20-22-27-28(26)29(36-25(3)32)30(31(33)37-27)35-24-19-17-15-13-11-9-7-5-2/h20-22H,4-19,23-24H2,1-3H3 |
| InChIKey | UWKGCSAWSMSUON-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.72 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|