C29H46O5 — CID 19929140
4,5-didecoxy-3-hydroxychromen-2-one (PubChem CID 19929140) has the molecular formula C29H46O5 and a molecular weight of 474.68 g/mol. Its IUPAC name is 4,5-didecoxy-3-hydroxychromen-2-one.
| Compound Name | 4,5-didecoxy-3-hydroxychromen-2-one |
|---|---|
| PubChem CID | 19929140 |
| Molecular Formula | C29H46O5 |
| Molecular Weight | 474.68 g/mol |
| Exact Mass | 474.33 |
| IUPAC Name | 4,5-didecoxy-3-hydroxychromen-2-one |
| SMILES | CCCCCCCCCCOc1cccc2oc(=O)c(O)c(OCCCCCCCCCC)c12 |
| InChI | InChI=1S/C29H46O5/c1-3-5-7-9-11-13-15-17-22-32-24-20-19-21-25-26(24)28(27(30)29(31)34-25)33-23-18-16-14-12-10-8-6-4-2/h19-21,30H,3-18,22-23H2,1-2H3 |
| InChIKey | NAPKQFOVBXZLNB-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.68 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|