C18H22O7 — CID 54696789
2-(3-heptoxy-4-hydroxy-2-oxochromen-5-yl)oxyacetic acid (PubChem CID 54696789) has the molecular formula C18H22O7 and a molecular weight of 350.37 g/mol. Its IUPAC name is 2-(3-heptoxy-4-hydroxy-2-oxochromen-5-yl)oxyacetic acid.
| Compound Name | 2-(3-heptoxy-4-hydroxy-2-oxochromen-5-yl)oxyacetic acid |
|---|---|
| PubChem CID | 54696789 |
| Molecular Formula | C18H22O7 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2-(3-heptoxy-4-hydroxy-2-oxochromen-5-yl)oxyacetic acid |
| SMILES | CCCCCCCOc1c(O)c2c(OCC(=O)O)cccc2oc1=O |
| InChI | InChI=1S/C18H22O7/c1-2-3-4-5-6-10-23-17-16(21)15-12(24-11-14(19)20)8-7-9-13(15)25-18(17)22/h7-9,21H,2-6,10-11H2,1H3,(H,19,20) |
| InChIKey | BJWWNHDWLAGIEW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|