C32H40O6 — CID 19928955
[3-decoxy-5-[(E)-hex-3-enoxy]-2-oxochromen-4-yl] benzoate (PubChem CID 19928955) has the molecular formula C32H40O6 and a molecular weight of 520.67 g/mol. Its IUPAC name is [3-decoxy-5-[(E)-hex-3-enoxy]-2-oxochromen-4-yl] benzoate.
| Compound Name | [3-decoxy-5-[(E)-hex-3-enoxy]-2-oxochromen-4-yl] benzoate |
|---|---|
| PubChem CID | 19928955 |
| Molecular Formula | C32H40O6 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | [3-decoxy-5-[(E)-hex-3-enoxy]-2-oxochromen-4-yl] benzoate |
| SMILES | CC/C=C/CCOc1cccc2oc(=O)c(OCCCCCCCCCC)c(OC(=O)c3ccccc3)c12 |
| InChI | InChI=1S/C32H40O6/c1-3-5-7-9-10-11-12-17-24-36-30-29(38-31(33)25-19-14-13-15-20-25)28-26(35-23-16-8-6-4-2)21-18-22-27(28)37-32(30)34/h6,8,13-15,18-22H,3-5,7,9-12,16-17,23-24H2,1-2H3/b8-6+ |
| InChIKey | PZVFLEULMPUGMR-SOFGYWHQSA-N |
| XLogP | 8.27 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|