C26H30O6 — CID 19928846
(3-decoxy-7-hydroxy-2-oxochromen-4-yl) benzoate (PubChem CID 19928846) has the molecular formula C26H30O6 and a molecular weight of 438.52 g/mol. Its IUPAC name is (3-decoxy-7-hydroxy-2-oxochromen-4-yl) benzoate.
| Compound Name | (3-decoxy-7-hydroxy-2-oxochromen-4-yl) benzoate |
|---|---|
| PubChem CID | 19928846 |
| Molecular Formula | C26H30O6 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | (3-decoxy-7-hydroxy-2-oxochromen-4-yl) benzoate |
| SMILES | CCCCCCCCCCOc1c(OC(=O)c2ccccc2)c2ccc(O)cc2oc1=O |
| InChI | InChI=1S/C26H30O6/c1-2-3-4-5-6-7-8-12-17-30-24-23(32-25(28)19-13-10-9-11-14-19)21-16-15-20(27)18-22(21)31-26(24)29/h9-11,13-16,18,27H,2-8,12,17H2,1H3 |
| InChIKey | VLCVDOOJXPSNRL-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|