C53H50O15 — CID 22867609
[(2R,3S,4S,5R,6S)-6-(3-acetyloxy-4-octoxy-2-oxochromen-7-yl)oxy-3,4,5-tribenzoyloxyoxan-2-yl]methyl benzoate (PubChem CID 22867609) has the molecular formula C53H50O15 and a molecular weight of 926.97 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-6-(3-acetyloxy-4-octoxy-2-oxochromen-7-yl)oxy-3,4,5-tribenzoyloxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4S,5R,6S)-6-(3-acetyloxy-4-octoxy-2-oxochromen-7-yl)oxy-3,4,5-tribenzoyloxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 22867609 |
| Molecular Formula | C53H50O15 |
| Molecular Weight | 926.97 g/mol |
| Exact Mass | 926.31 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-(3-acetyloxy-4-octoxy-2-oxochromen-7-yl)oxy-3,4,5-tribenzoyloxyoxan-2-yl]methyl benzoate |
| SMILES | CCCCCCCCOc1c(OC(C)=O)c(=O)oc2cc(O[C@@H]3O[C@H](COC(=O)c4ccccc4)[C@H](OC(=O)c4ccccc4)[C@H](OC(=O)c4ccccc4)[C@H]3OC(=O)c3ccccc3)ccc12 |
| InChI | InChI=1S/C53H50O15/c1-3-4-5-6-7-20-31-60-43-40-30-29-39(32-41(40)64-52(59)46(43)62-34(2)54)63-53-47(68-51(58)38-27-18-11-19-28-38)45(67-50(57)37-25-16-10-17-26-37)44(66-49(56)36-23-14-9-15-24-36)42(65-53)33-61-48(55)35-21-12-8-13-22-35/h8-19,21-30,32,42,44-45,47,53H,3-7,20,31,33H2,1-2H3/t42-,44+,45+,47-,53-/m1/s1 |
| InChIKey | GDWHYTXOSVGDLX-ORGFCULISA-N |
| XLogP | 9.10 |
| TPSA | 189.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 926.97 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|