C46H36O15 — CID 54737324
[(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-(4-hydroxy-2-oxo-3-propanoyloxychromen-7-yl)oxyoxan-2-yl]methyl benzoate (PubChem CID 54737324) has the molecular formula C46H36O15 and a molecular weight of 828.78 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-(4-hydroxy-2-oxo-3-propanoyloxychromen-7-yl)oxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-(4-hydroxy-2-oxo-3-propanoyloxychromen-7-yl)oxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 54737324 |
| Molecular Formula | C46H36O15 |
| Molecular Weight | 828.78 g/mol |
| Exact Mass | 828.21 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-(4-hydroxy-2-oxo-3-propanoyloxychromen-7-yl)oxyoxan-2-yl]methyl benzoate |
| SMILES | CCC(=O)Oc1c(O)c2ccc(O[C@@H]3O[C@H](COC(=O)c4ccccc4)[C@@H](OC(=O)c4ccccc4)[C@H](OC(=O)c4ccccc4)[C@H]3OC(=O)c3ccccc3)cc2oc1=O |
| InChI | InChI=1S/C46H36O15/c1-2-35(47)58-38-36(48)32-24-23-31(25-33(32)56-45(38)53)55-46-40(61-44(52)30-21-13-6-14-22-30)39(60-43(51)29-19-11-5-12-20-29)37(59-42(50)28-17-9-4-10-18-28)34(57-46)26-54-41(49)27-15-7-3-8-16-27/h3-25,34,37,39-40,46,48H,2,26H2,1H3/t34-,37-,39+,40-,46-/m1/s1 |
| InChIKey | CGXUVEKLCQEJTP-ADCVITEFSA-N |
| XLogP | 6.45 |
| TPSA | 200.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.78 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|