C60H54O14 — CID 54476500
[(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-[3-(3,7-dimethylocta-2,6-dienoxy)-2-oxo-4-phenylmethoxychromen-7-yl]oxyoxan-2-yl]methyl benzoate (PubChem CID 54476500) has the molecular formula C60H54O14 and a molecular weight of 999.08 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-[3-(3,7-dimethylocta-2,6-dienoxy)-2-oxo-4-phenylmethoxychromen-7-yl]oxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-[3-(3,7-dimethylocta-2,6-dienoxy)-2-oxo-4-phenylmethoxychromen-7-yl]oxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 54476500 |
| Molecular Formula | C60H54O14 |
| Molecular Weight | 999.08 g/mol |
| Exact Mass | 998.35 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-[3-(3,7-dimethylocta-2,6-dienoxy)-2-oxo-4-phenylmethoxychromen-7-yl]oxyoxan-2-yl]methyl benzoate |
| SMILES | CC(C)=CCCC(C)=CCOc1c(OCc2ccccc2)c2ccc(O[C@@H]3O[C@H](COC(=O)c4ccccc4)[C@@H](OC(=O)c4ccccc4)[C@H](OC(=O)c4ccccc4)[C@H]3OC(=O)c3ccccc3)cc2oc1=O |
| InChI | InChI=1S/C60H54O14/c1-39(2)20-19-21-40(3)34-35-66-53-50(67-37-41-22-9-4-10-23-41)47-33-32-46(36-48(47)70-59(53)65)69-60-54(74-58(64)45-30-17-8-18-31-45)52(73-57(63)44-28-15-7-16-29-44)51(72-56(62)43-26-13-6-14-27-43)49(71-60)38-68-55(61)42-24-11-5-12-25-42/h4-18,20,22-34,36,49,51-52,54,60H,19,21,35,37-38H2,1-3H3/t49-,51-,52+,54-,60-/m1/s1 |
| InChIKey | XLYOQPBBAVCKAA-UUJMOISOSA-N |
| XLogP | 11.08 |
| TPSA | 172.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 999.08 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|