C35H42O15 — CID 54304719
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[3-acetyloxy-4-(3,7-dimethylocta-2,6-dienoxy)-2-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 54304719) has the molecular formula C35H42O15 and a molecular weight of 702.71 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[3-acetyloxy-4-(3,7-dimethylocta-2,6-dienoxy)-2-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[3-acetyloxy-4-(3,7-dimethylocta-2,6-dienoxy)-2-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 54304719 |
| Molecular Formula | C35H42O15 |
| Molecular Weight | 702.71 g/mol |
| Exact Mass | 702.25 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[3-acetyloxy-4-(3,7-dimethylocta-2,6-dienoxy)-2-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2ccc3c(OCC=C(C)CCC=C(C)C)c(OC(C)=O)c(=O)oc3c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C35H42O15/c1-18(2)10-9-11-19(3)14-15-42-29-26-13-12-25(16-27(26)49-34(41)32(29)46-23(7)39)48-35-33(47-24(8)40)31(45-22(6)38)30(44-21(5)37)28(50-35)17-43-20(4)36/h10,12-14,16,28,30-31,33,35H,9,11,15,17H2,1-8H3/t28-,30+,31+,33-,35-/m1/s1 |
| InChIKey | SGRSHLZZZOAXFU-LUTLHJFQSA-N |
| XLogP | 4.25 |
| TPSA | 189.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.71 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|