C25H32O10 — CID 57230831
3-(3,7-dimethylocta-2,6-dienoxy)-4-hydroxy-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one (PubChem CID 57230831) has the molecular formula C25H32O10 and a molecular weight of 492.52 g/mol. Its IUPAC name is 3-(3,7-dimethylocta-2,6-dienoxy)-4-hydroxy-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one.
| Compound Name | 3-(3,7-dimethylocta-2,6-dienoxy)-4-hydroxy-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one |
|---|---|
| PubChem CID | 57230831 |
| Molecular Formula | C25H32O10 |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 3-(3,7-dimethylocta-2,6-dienoxy)-4-hydroxy-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one |
| SMILES | CC(C)=CCCC(C)=CCOc1c(O)c2ccc(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)cc2oc1=O |
| InChI | InChI=1S/C25H32O10/c1-13(2)5-4-6-14(3)9-10-32-23-19(27)16-8-7-15(11-17(16)34-24(23)31)33-25-22(30)21(29)20(28)18(12-26)35-25/h5,7-9,11,18,20-22,25-30H,4,6,10,12H2,1-3H3/t18-,20+,21+,22-,25-/m1/s1 |
| InChIKey | UNSZFAWLSHMBGO-XCXOWRKTSA-N |
| XLogP | 1.75 |
| TPSA | 159.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|