C29H42O5 — CID 54690482
7-decoxy-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxychromen-2-one (PubChem CID 54690482) has the molecular formula C29H42O5 and a molecular weight of 470.65 g/mol. Its IUPAC name is 7-decoxy-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxychromen-2-one.
| Compound Name | 7-decoxy-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 54690482 |
| Molecular Formula | C29H42O5 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | 7-decoxy-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxychromen-2-one |
| SMILES | CCCCCCCCCCOc1ccc2c(O)c(OC/C=C(\C)CCC=C(C)C)c(=O)oc2c1 |
| InChI | InChI=1S/C29H42O5/c1-5-6-7-8-9-10-11-12-19-32-24-16-17-25-26(21-24)34-29(31)28(27(25)30)33-20-18-23(4)15-13-14-22(2)3/h14,16-18,21,30H,5-13,15,19-20H2,1-4H3/b23-18+ |
| InChIKey | SFMOLPYMMVIWHL-PTGBLXJZSA-N |
| XLogP | 8.09 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|