C25H32O5 — CID 54738951
3-(3,7-dimethylocta-2,6-dienoxy)-7-hex-3-enoxy-4-hydroxychromen-2-one (PubChem CID 54738951) has the molecular formula C25H32O5 and a molecular weight of 412.53 g/mol. Its IUPAC name is 3-(3,7-dimethylocta-2,6-dienoxy)-7-hex-3-enoxy-4-hydroxychromen-2-one.
| Compound Name | 3-(3,7-dimethylocta-2,6-dienoxy)-7-hex-3-enoxy-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 54738951 |
| Molecular Formula | C25H32O5 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 3-(3,7-dimethylocta-2,6-dienoxy)-7-hex-3-enoxy-4-hydroxychromen-2-one |
| SMILES | CCC=CCCOc1ccc2c(O)c(OCC=C(C)CCC=C(C)C)c(=O)oc2c1 |
| InChI | InChI=1S/C25H32O5/c1-5-6-7-8-15-28-20-12-13-21-22(17-20)30-25(27)24(23(21)26)29-16-14-19(4)11-9-10-18(2)3/h6-7,10,12-14,17,26H,5,8-9,11,15-16H2,1-4H3 |
| InChIKey | ABMPGZYGGWVKGU-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|