C18H22O5 — CID 54690514
7-[(E)-hex-3-enoxy]-4-hydroxy-3-propan-2-yloxychromen-2-one (PubChem CID 54690514) has the molecular formula C18H22O5 and a molecular weight of 318.37 g/mol. Its IUPAC name is 7-[(E)-hex-3-enoxy]-4-hydroxy-3-propan-2-yloxychromen-2-one.
| Compound Name | 7-[(E)-hex-3-enoxy]-4-hydroxy-3-propan-2-yloxychromen-2-one |
|---|---|
| PubChem CID | 54690514 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 7-[(E)-hex-3-enoxy]-4-hydroxy-3-propan-2-yloxychromen-2-one |
| SMILES | CC/C=C/CCOc1ccc2c(O)c(OC(C)C)c(=O)oc2c1 |
| InChI | InChI=1S/C18H22O5/c1-4-5-6-7-10-21-13-8-9-14-15(11-13)23-18(20)17(16(14)19)22-12(2)3/h5-6,8-9,11-12,19H,4,7,10H2,1-3H3/b6-5+ |
| InChIKey | PFTNYVWFNUAIPN-AATRIKPKSA-N |
| XLogP | 4.02 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|