C31H46O5 — CID 19929786
4-decoxy-3,7-bis[(E)-hex-3-enoxy]chromen-2-one (PubChem CID 19929786) has the molecular formula C31H46O5 and a molecular weight of 498.70 g/mol. Its IUPAC name is 4-decoxy-3,7-bis[(E)-hex-3-enoxy]chromen-2-one.
| Compound Name | 4-decoxy-3,7-bis[(E)-hex-3-enoxy]chromen-2-one |
|---|---|
| PubChem CID | 19929786 |
| Molecular Formula | C31H46O5 |
| Molecular Weight | 498.70 g/mol |
| Exact Mass | 498.33 |
| IUPAC Name | 4-decoxy-3,7-bis[(E)-hex-3-enoxy]chromen-2-one |
| SMILES | CC/C=C/CCOc1ccc2c(OCCCCCCCCCC)c(OCC/C=C/CC)c(=O)oc2c1 |
| InChI | InChI=1S/C31H46O5/c1-4-7-10-13-14-15-16-19-23-34-29-27-21-20-26(33-22-17-11-8-5-2)25-28(27)36-31(32)30(29)35-24-18-12-9-6-3/h8-9,11-12,20-21,25H,4-7,10,13-19,22-24H2,1-3H3/b11-8+,12-9+ |
| InChIKey | ROJRAFCVMUMVOU-HZOWPXDZSA-N |
| XLogP | 8.78 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.70 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|