C25H34O5 — CID 54312103
3,4-bis(hex-3-enoxy)-7-[(2-methylpropan-2-yl)oxy]chromen-2-one (PubChem CID 54312103) has the molecular formula C25H34O5 and a molecular weight of 414.54 g/mol. Its IUPAC name is 3,4-bis(hex-3-enoxy)-7-[(2-methylpropan-2-yl)oxy]chromen-2-one.
| Compound Name | 3,4-bis(hex-3-enoxy)-7-[(2-methylpropan-2-yl)oxy]chromen-2-one |
|---|---|
| PubChem CID | 54312103 |
| Molecular Formula | C25H34O5 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 3,4-bis(hex-3-enoxy)-7-[(2-methylpropan-2-yl)oxy]chromen-2-one |
| SMILES | CCC=CCCOc1c(OCCC=CCC)c2ccc(OC(C)(C)C)cc2oc1=O |
| InChI | InChI=1S/C25H34O5/c1-6-8-10-12-16-27-22-20-15-14-19(30-25(3,4)5)18-21(20)29-24(26)23(22)28-17-13-11-9-7-2/h8-11,14-15,18H,6-7,12-13,16-17H2,1-5H3 |
| InChIKey | SLPOURFWEOBHBL-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|