C18H20O6 — CID 54156543
(3-hex-3-enoxy-4-methoxy-2-oxochromen-7-yl) acetate (PubChem CID 54156543) has the molecular formula C18H20O6 and a molecular weight of 332.35 g/mol. Its IUPAC name is (3-hex-3-enoxy-4-methoxy-2-oxochromen-7-yl) acetate.
| Compound Name | (3-hex-3-enoxy-4-methoxy-2-oxochromen-7-yl) acetate |
|---|---|
| PubChem CID | 54156543 |
| Molecular Formula | C18H20O6 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (3-hex-3-enoxy-4-methoxy-2-oxochromen-7-yl) acetate |
| SMILES | CCC=CCCOc1c(OC)c2ccc(OC(C)=O)cc2oc1=O |
| InChI | InChI=1S/C18H20O6/c1-4-5-6-7-10-22-17-16(21-3)14-9-8-13(23-12(2)19)11-15(14)24-18(17)20/h5-6,8-9,11H,4,7,10H2,1-3H3 |
| InChIKey | OLLRFMZROBWDGF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|