C21H28O5 — CID 54183997
3-hex-3-enoxy-4,7-di(propan-2-yloxy)chromen-2-one (PubChem CID 54183997) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is 3-hex-3-enoxy-4,7-di(propan-2-yloxy)chromen-2-one.
| Compound Name | 3-hex-3-enoxy-4,7-di(propan-2-yloxy)chromen-2-one |
|---|---|
| PubChem CID | 54183997 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 3-hex-3-enoxy-4,7-di(propan-2-yloxy)chromen-2-one |
| SMILES | CCC=CCCOc1c(OC(C)C)c2ccc(OC(C)C)cc2oc1=O |
| InChI | InChI=1S/C21H28O5/c1-6-7-8-9-12-23-20-19(25-15(4)5)17-11-10-16(24-14(2)3)13-18(17)26-21(20)22/h7-8,10-11,13-15H,6,9,12H2,1-5H3 |
| InChIKey | PDVHQBPJTQODKZ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|