C28H38O5 — CID 19929746
4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-[(E)-hex-3-enoxy]-3-propan-2-yloxychromen-2-one (PubChem CID 19929746) has the molecular formula C28H38O5 and a molecular weight of 454.61 g/mol. Its IUPAC name is 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-[(E)-hex-3-enoxy]-3-propan-2-yloxychromen-2-one.
| Compound Name | 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-[(E)-hex-3-enoxy]-3-propan-2-yloxychromen-2-one |
|---|---|
| PubChem CID | 19929746 |
| Molecular Formula | C28H38O5 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-7-[(E)-hex-3-enoxy]-3-propan-2-yloxychromen-2-one |
| SMILES | CC/C=C/CCOc1ccc2c(OC/C=C(\C)CCC=C(C)C)c(OC(C)C)c(=O)oc2c1 |
| InChI | InChI=1S/C28H38O5/c1-7-8-9-10-17-30-23-14-15-24-25(19-23)33-28(29)27(32-21(4)5)26(24)31-18-16-22(6)13-11-12-20(2)3/h8-9,12,14-16,19,21H,7,10-11,13,17-18H2,1-6H3/b9-8+,22-16+ |
| InChIKey | HEWHVNGXPKXZJF-XEBHLSMGSA-N |
| XLogP | 7.39 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|