C26H34O5 — CID 19929733
3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-[(E)-hex-3-enoxy]-7-methoxychromen-2-one (PubChem CID 19929733) has the molecular formula C26H34O5 and a molecular weight of 426.55 g/mol. Its IUPAC name is 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-[(E)-hex-3-enoxy]-7-methoxychromen-2-one.
| Compound Name | 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-[(E)-hex-3-enoxy]-7-methoxychromen-2-one |
|---|---|
| PubChem CID | 19929733 |
| Molecular Formula | C26H34O5 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-[(E)-hex-3-enoxy]-7-methoxychromen-2-one |
| SMILES | CC/C=C/CCOc1c(OC/C=C(\C)CCC=C(C)C)c(=O)oc2cc(OC)ccc12 |
| InChI | InChI=1S/C26H34O5/c1-6-7-8-9-16-29-24-22-14-13-21(28-5)18-23(22)31-26(27)25(24)30-17-15-20(4)12-10-11-19(2)3/h7-8,11,13-15,18H,6,9-10,12,16-17H2,1-5H3/b8-7+,20-15+ |
| InChIKey | XQZNPKMLXHUMBP-JWVVLAAESA-N |
| XLogP | 6.61 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|