C27H28O6 — CID 54443378
[4-(3,7-dimethylocta-2,6-dienoxy)-7-methoxy-2-oxochromen-3-yl] benzoate (PubChem CID 54443378) has the molecular formula C27H28O6 and a molecular weight of 448.52 g/mol. Its IUPAC name is [4-(3,7-dimethylocta-2,6-dienoxy)-7-methoxy-2-oxochromen-3-yl] benzoate.
| Compound Name | [4-(3,7-dimethylocta-2,6-dienoxy)-7-methoxy-2-oxochromen-3-yl] benzoate |
|---|---|
| PubChem CID | 54443378 |
| Molecular Formula | C27H28O6 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | [4-(3,7-dimethylocta-2,6-dienoxy)-7-methoxy-2-oxochromen-3-yl] benzoate |
| SMILES | COc1ccc2c(OCC=C(C)CCC=C(C)C)c(OC(=O)c3ccccc3)c(=O)oc2c1 |
| InChI | InChI=1S/C27H28O6/c1-18(2)9-8-10-19(3)15-16-31-24-22-14-13-21(30-4)17-23(22)32-27(29)25(24)33-26(28)20-11-6-5-7-12-20/h5-7,9,11-15,17H,8,10,16H2,1-4H3 |
| InChIKey | WPSMKMKKGPAWHF-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|