C30H44O5 — CID 19929896
7-decoxy-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-methoxychromen-2-one (PubChem CID 19929896) has the molecular formula C30H44O5 and a molecular weight of 484.68 g/mol. Its IUPAC name is 7-decoxy-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-methoxychromen-2-one.
| Compound Name | 7-decoxy-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-methoxychromen-2-one |
|---|---|
| PubChem CID | 19929896 |
| Molecular Formula | C30H44O5 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | 7-decoxy-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-methoxychromen-2-one |
| SMILES | CCCCCCCCCCOc1ccc2c(OC)c(OC/C=C(\C)CCC=C(C)C)c(=O)oc2c1 |
| InChI | InChI=1S/C30H44O5/c1-6-7-8-9-10-11-12-13-20-33-25-17-18-26-27(22-25)35-30(31)29(28(26)32-5)34-21-19-24(4)16-14-15-23(2)3/h15,17-19,22H,6-14,16,20-21H2,1-5H3/b24-19+ |
| InChIKey | MZLHZRSNELGSMK-LYBHJNIJSA-N |
| XLogP | 8.39 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|