C39H58O5 — CID 54265767
4-decoxy-3,5-bis(3,7-dimethylocta-2,6-dienoxy)chromen-2-one (PubChem CID 54265767) has the molecular formula C39H58O5 and a molecular weight of 606.89 g/mol. Its IUPAC name is 4-decoxy-3,5-bis(3,7-dimethylocta-2,6-dienoxy)chromen-2-one.
| Compound Name | 4-decoxy-3,5-bis(3,7-dimethylocta-2,6-dienoxy)chromen-2-one |
|---|---|
| PubChem CID | 54265767 |
| Molecular Formula | C39H58O5 |
| Molecular Weight | 606.89 g/mol |
| Exact Mass | 606.43 |
| IUPAC Name | 4-decoxy-3,5-bis(3,7-dimethylocta-2,6-dienoxy)chromen-2-one |
| SMILES | CCCCCCCCCCOc1c(OCC=C(C)CCC=C(C)C)c(=O)oc2cccc(OCC=C(C)CCC=C(C)C)c12 |
| InChI | InChI=1S/C39H58O5/c1-8-9-10-11-12-13-14-15-27-42-37-36-34(41-28-25-32(6)21-16-19-30(2)3)23-18-24-35(36)44-39(40)38(37)43-29-26-33(7)22-17-20-31(4)5/h18-20,23-26H,8-17,21-22,27-29H2,1-7H3 |
| InChIKey | RGQJOYBVKDZUFL-UHFFFAOYSA-N |
| XLogP | 11.46 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.89 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|