C36H46O6 — CID 19929364
[3-decoxy-8-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-oxochromen-4-yl] benzoate (PubChem CID 19929364) has the molecular formula C36H46O6 and a molecular weight of 574.76 g/mol. Its IUPAC name is [3-decoxy-8-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-oxochromen-4-yl] benzoate.
| Compound Name | [3-decoxy-8-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-oxochromen-4-yl] benzoate |
|---|---|
| PubChem CID | 19929364 |
| Molecular Formula | C36H46O6 |
| Molecular Weight | 574.76 g/mol |
| Exact Mass | 574.33 |
| IUPAC Name | [3-decoxy-8-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-oxochromen-4-yl] benzoate |
| SMILES | CCCCCCCCCCOc1c(OC(=O)c2ccccc2)c2cccc(OC/C=C(\C)CCC=C(C)C)c2oc1=O |
| InChI | InChI=1S/C36H46O6/c1-5-6-7-8-9-10-11-15-25-40-34-33(42-35(37)29-20-13-12-14-21-29)30-22-17-23-31(32(30)41-36(34)38)39-26-24-28(4)19-16-18-27(2)3/h12-14,17-18,20-24H,5-11,15-16,19,25-26H2,1-4H3/b28-24+ |
| InChIKey | ITQDRWCTBKIISY-ZZIIXHQDSA-N |
| XLogP | 9.60 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.76 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|