C35H52O5 — CID 19929668
3-decoxy-5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-[(E)-hex-3-enoxy]chromen-2-one (PubChem CID 19929668) has the molecular formula C35H52O5 and a molecular weight of 552.80 g/mol. Its IUPAC name is 3-decoxy-5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-[(E)-hex-3-enoxy]chromen-2-one.
| Compound Name | 3-decoxy-5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-[(E)-hex-3-enoxy]chromen-2-one |
|---|---|
| PubChem CID | 19929668 |
| Molecular Formula | C35H52O5 |
| Molecular Weight | 552.80 g/mol |
| Exact Mass | 552.38 |
| IUPAC Name | 3-decoxy-5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-[(E)-hex-3-enoxy]chromen-2-one |
| SMILES | CC/C=C/CCOc1c(OCCCCCCCCCC)c(=O)oc2cccc(OC/C=C(\C)CCC=C(C)C)c12 |
| InChI | InChI=1S/C35H52O5/c1-6-8-10-12-13-14-15-17-26-39-34-33(38-25-16-11-9-7-2)32-30(22-19-23-31(32)40-35(34)36)37-27-24-29(5)21-18-20-28(3)4/h9,11,19-20,22-24H,6-8,10,12-18,21,25-27H2,1-5H3/b11-9+,29-24+ |
| InChIKey | DEPFZBGSKXSNLK-UZQYWHTISA-N |
| XLogP | 10.12 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.80 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|