C28H42O5 — CID 54306309
4-decoxy-5-hex-3-enoxy-3-propan-2-yloxychromen-2-one (PubChem CID 54306309) has the molecular formula C28H42O5 and a molecular weight of 458.64 g/mol. Its IUPAC name is 4-decoxy-5-hex-3-enoxy-3-propan-2-yloxychromen-2-one.
| Compound Name | 4-decoxy-5-hex-3-enoxy-3-propan-2-yloxychromen-2-one |
|---|---|
| PubChem CID | 54306309 |
| Molecular Formula | C28H42O5 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | 4-decoxy-5-hex-3-enoxy-3-propan-2-yloxychromen-2-one |
| SMILES | CCC=CCCOc1cccc2oc(=O)c(OC(C)C)c(OCCCCCCCCCC)c12 |
| InChI | InChI=1S/C28H42O5/c1-5-7-9-11-12-13-14-16-21-31-26-25-23(30-20-15-10-8-6-2)18-17-19-24(25)33-28(29)27(26)32-22(3)4/h8,10,17-19,22H,5-7,9,11-16,20-21H2,1-4H3 |
| InChIKey | SHTRGGRMRMNZCH-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|