C26H38O5 — CID 19929249
3-decoxy-4-[(E)-hex-3-enoxy]-8-methoxychromen-2-one (PubChem CID 19929249) has the molecular formula C26H38O5 and a molecular weight of 430.59 g/mol. Its IUPAC name is 3-decoxy-4-[(E)-hex-3-enoxy]-8-methoxychromen-2-one.
| Compound Name | 3-decoxy-4-[(E)-hex-3-enoxy]-8-methoxychromen-2-one |
|---|---|
| PubChem CID | 19929249 |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 3-decoxy-4-[(E)-hex-3-enoxy]-8-methoxychromen-2-one |
| SMILES | CC/C=C/CCOc1c(OCCCCCCCCCC)c(=O)oc2c(OC)cccc12 |
| InChI | InChI=1S/C26H38O5/c1-4-6-8-10-11-12-13-15-20-30-25-24(29-19-14-9-7-5-2)21-17-16-18-22(28-3)23(21)31-26(25)27/h7,9,16-18H,4-6,8,10-15,19-20H2,1-3H3/b9-7+ |
| InChIKey | PWDXDTZVTWJHGC-VQHVLOKHSA-N |
| XLogP | 7.06 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|