C23H28O6 — CID 54569514
[4,8-bis(hex-3-enoxy)-2-oxochromen-3-yl] acetate (PubChem CID 54569514) has the molecular formula C23H28O6 and a molecular weight of 400.47 g/mol. Its IUPAC name is [4,8-bis(hex-3-enoxy)-2-oxochromen-3-yl] acetate.
| Compound Name | [4,8-bis(hex-3-enoxy)-2-oxochromen-3-yl] acetate |
|---|---|
| PubChem CID | 54569514 |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | [4,8-bis(hex-3-enoxy)-2-oxochromen-3-yl] acetate |
| SMILES | CCC=CCCOc1c(OC(C)=O)c(=O)oc2c(OCCC=CCC)cccc12 |
| InChI | InChI=1S/C23H28O6/c1-4-6-8-10-15-26-19-14-12-13-18-20(19)29-23(25)22(28-17(3)24)21(18)27-16-11-9-7-5-2/h6-9,12-14H,4-5,10-11,15-16H2,1-3H3 |
| InChIKey | ZWGCDRYWYWEGHK-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|