C28H38O5 — CID 54489043
4-(3,7-dimethylocta-2,6-dienoxy)-3-hex-3-enoxy-8-propan-2-yloxychromen-2-one (PubChem CID 54489043) has the molecular formula C28H38O5 and a molecular weight of 454.61 g/mol. Its IUPAC name is 4-(3,7-dimethylocta-2,6-dienoxy)-3-hex-3-enoxy-8-propan-2-yloxychromen-2-one.
| Compound Name | 4-(3,7-dimethylocta-2,6-dienoxy)-3-hex-3-enoxy-8-propan-2-yloxychromen-2-one |
|---|---|
| PubChem CID | 54489043 |
| Molecular Formula | C28H38O5 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 4-(3,7-dimethylocta-2,6-dienoxy)-3-hex-3-enoxy-8-propan-2-yloxychromen-2-one |
| SMILES | CCC=CCCOc1c(OCC=C(C)CCC=C(C)C)c2cccc(OC(C)C)c2oc1=O |
| InChI | InChI=1S/C28H38O5/c1-7-8-9-10-18-30-27-26(31-19-17-22(6)14-11-13-20(2)3)23-15-12-16-24(32-21(4)5)25(23)33-28(27)29/h8-9,12-13,15-17,21H,7,10-11,14,18-19H2,1-6H3 |
| InChIKey | XUKYPULTTXIGTI-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|