C23H30O5 — CID 19929290
8-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-methoxy-3-propan-2-yloxychromen-2-one (PubChem CID 19929290) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is 8-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-methoxy-3-propan-2-yloxychromen-2-one.
| Compound Name | 8-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-methoxy-3-propan-2-yloxychromen-2-one |
|---|---|
| PubChem CID | 19929290 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 8-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-methoxy-3-propan-2-yloxychromen-2-one |
| SMILES | COc1c(OC(C)C)c(=O)oc2c(OC/C=C(\C)CCC=C(C)C)cccc12 |
| InChI | InChI=1S/C23H30O5/c1-15(2)9-7-10-17(5)13-14-26-19-12-8-11-18-20(19)28-23(24)22(21(18)25-6)27-16(3)4/h8-9,11-13,16H,7,10,14H2,1-6H3/b17-13+ |
| InChIKey | PVCXKNABDSHQKL-GHRIWEEISA-N |
| XLogP | 5.66 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|