C32H36O6 — CID 54188126
[8-(3,7-dimethylocta-2,6-dienoxy)-3-hex-3-enoxy-2-oxochromen-4-yl] benzoate (PubChem CID 54188126) has the molecular formula C32H36O6 and a molecular weight of 516.63 g/mol. Its IUPAC name is [8-(3,7-dimethylocta-2,6-dienoxy)-3-hex-3-enoxy-2-oxochromen-4-yl] benzoate.
| Compound Name | [8-(3,7-dimethylocta-2,6-dienoxy)-3-hex-3-enoxy-2-oxochromen-4-yl] benzoate |
|---|---|
| PubChem CID | 54188126 |
| Molecular Formula | C32H36O6 |
| Molecular Weight | 516.63 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | [8-(3,7-dimethylocta-2,6-dienoxy)-3-hex-3-enoxy-2-oxochromen-4-yl] benzoate |
| SMILES | CCC=CCCOc1c(OC(=O)c2ccccc2)c2cccc(OCC=C(C)CCC=C(C)C)c2oc1=O |
| InChI | InChI=1S/C32H36O6/c1-5-6-7-11-21-36-30-29(38-31(33)25-16-9-8-10-17-25)26-18-13-19-27(28(26)37-32(30)34)35-22-20-24(4)15-12-14-23(2)3/h6-10,13-14,16-20H,5,11-12,15,21-22H2,1-4H3 |
| InChIKey | PGOKBOFATBHQEO-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.63 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|