C31H47NO4 — CID 139718020
3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-methoxy-7-octoxy-1-propan-2-ylquinolin-2-one (PubChem CID 139718020) has the molecular formula C31H47NO4 and a molecular weight of 497.72 g/mol. Its IUPAC name is 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-methoxy-7-octoxy-1-propan-2-ylquinolin-2-one.
| Compound Name | 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-methoxy-7-octoxy-1-propan-2-ylquinolin-2-one |
|---|---|
| PubChem CID | 139718020 |
| Molecular Formula | C31H47NO4 |
| Molecular Weight | 497.72 g/mol |
| Exact Mass | 497.35 |
| IUPAC Name | 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-methoxy-7-octoxy-1-propan-2-ylquinolin-2-one |
| SMILES | CCCCCCCCOc1ccc2c(OC)c(OC/C=C(\C)CCC=C(C)C)c(=O)n(C(C)C)c2c1 |
| InChI | InChI=1S/C31H47NO4/c1-8-9-10-11-12-13-20-35-26-17-18-27-28(22-26)32(24(4)5)31(33)30(29(27)34-7)36-21-19-25(6)16-14-15-23(2)3/h15,17-19,22,24H,8-14,16,20-21H2,1-7H3/b25-19+ |
| InChIKey | UFROREAAUIPYTA-NCELDCMTSA-N |
| XLogP | 8.40 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.72 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|