C33H43NO4 — CID 139718309
3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-hexyl-4-methoxy-7-phenylmethoxyquinolin-2-one (PubChem CID 139718309) has the molecular formula C33H43NO4 and a molecular weight of 517.71 g/mol. Its IUPAC name is 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-hexyl-4-methoxy-7-phenylmethoxyquinolin-2-one.
| Compound Name | 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-hexyl-4-methoxy-7-phenylmethoxyquinolin-2-one |
|---|---|
| PubChem CID | 139718309 |
| Molecular Formula | C33H43NO4 |
| Molecular Weight | 517.71 g/mol |
| Exact Mass | 517.32 |
| IUPAC Name | 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-hexyl-4-methoxy-7-phenylmethoxyquinolin-2-one |
| SMILES | CCCCCCn1c(=O)c(OC/C=C(\C)CCC=C(C)C)c(OC)c2ccc(OCc3ccccc3)cc21 |
| InChI | InChI=1S/C33H43NO4/c1-6-7-8-12-21-34-30-23-28(38-24-27-16-10-9-11-17-27)18-19-29(30)31(36-5)32(33(34)35)37-22-20-26(4)15-13-14-25(2)3/h9-11,14,16-20,23H,6-8,12-13,15,21-22,24H2,1-5H3/b26-20+ |
| InChIKey | BCMNVYSJWWEOQW-LHLOQNFPSA-N |
| XLogP | 8.24 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.71 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|