C30H39NO4 — CID 139718331
3-methoxy-4-(3-methylbut-2-enoxy)-1-octyl-7-phenylmethoxyquinolin-2-one (PubChem CID 139718331) has the molecular formula C30H39NO4 and a molecular weight of 477.65 g/mol. Its IUPAC name is 3-methoxy-4-(3-methylbut-2-enoxy)-1-octyl-7-phenylmethoxyquinolin-2-one.
| Compound Name | 3-methoxy-4-(3-methylbut-2-enoxy)-1-octyl-7-phenylmethoxyquinolin-2-one |
|---|---|
| PubChem CID | 139718331 |
| Molecular Formula | C30H39NO4 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.29 |
| IUPAC Name | 3-methoxy-4-(3-methylbut-2-enoxy)-1-octyl-7-phenylmethoxyquinolin-2-one |
| SMILES | CCCCCCCCn1c(=O)c(OC)c(OCC=C(C)C)c2ccc(OCc3ccccc3)cc21 |
| InChI | InChI=1S/C30H39NO4/c1-5-6-7-8-9-13-19-31-27-21-25(35-22-24-14-11-10-12-15-24)16-17-26(27)28(29(33-4)30(31)32)34-20-18-23(2)3/h10-12,14-18,21H,5-9,13,19-20,22H2,1-4H3 |
| InChIKey | GFDRCZVVVSREIP-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|