C36H49NO4 — CID 139717098
1-butyl-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hexoxy-7-phenylmethoxyquinolin-2-one (PubChem CID 139717098) has the molecular formula C36H49NO4 and a molecular weight of 559.79 g/mol. Its IUPAC name is 1-butyl-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hexoxy-7-phenylmethoxyquinolin-2-one.
| Compound Name | 1-butyl-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hexoxy-7-phenylmethoxyquinolin-2-one |
|---|---|
| PubChem CID | 139717098 |
| Molecular Formula | C36H49NO4 |
| Molecular Weight | 559.79 g/mol |
| Exact Mass | 559.37 |
| IUPAC Name | 1-butyl-3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hexoxy-7-phenylmethoxyquinolin-2-one |
| SMILES | CCCCCCOc1c(OC/C=C(\C)CCC=C(C)C)c(=O)n(CCCC)c2cc(OCc3ccccc3)ccc12 |
| InChI | InChI=1S/C36H49NO4/c1-6-8-10-14-24-39-34-32-21-20-31(41-27-30-18-12-11-13-19-30)26-33(32)37(23-9-7-2)36(38)35(34)40-25-22-29(5)17-15-16-28(3)4/h11-13,16,18-22,26H,6-10,14-15,17,23-25,27H2,1-5H3/b29-22+ |
| InChIKey | LYOGFTYDGCUDIY-QUPMIFSKSA-N |
| XLogP | 9.41 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.79 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|